C28H31ClO10 — CID 150543634
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-(4-ethoxyphenyl)phenyl]oxan-2-yl]methyl acetate (PubChem CID 150543634) has the molecular formula C28H31ClO10 and a molecular weight of 563.00 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-(4-ethoxyphenyl)phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-(4-ethoxyphenyl)phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 150543634 |
| Molecular Formula | C28H31ClO10 |
| Molecular Weight | 563.00 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-(4-ethoxyphenyl)phenyl]oxan-2-yl]methyl acetate |
| SMILES | CCOc1ccc(-c2cc([C@@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)C3OC(C)=O)ccc2Cl)cc1 |
| InChI | InChI=1S/C28H31ClO10/c1-6-34-21-10-7-19(8-11-21)22-13-20(9-12-23(22)29)25-27(37-17(4)32)28(38-18(5)33)26(36-16(3)31)24(39-25)14-35-15(2)30/h7-13,24-28H,6,14H2,1-5H3/t24-,25+,26-,27?,28+/m1/s1 |
| InChIKey | IGKGOPFNRPXMDW-CZHHUUKFSA-N |
| XLogP | 4.20 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.00 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|