C21H25NO9 — CID 11351041
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[(E)-benzylideneamino]oxan-2-yl]methyl acetate (PubChem CID 11351041) has the molecular formula C21H25NO9 and a molecular weight of 435.43 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[(E)-benzylideneamino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[(E)-benzylideneamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11351041 |
| Molecular Formula | C21H25NO9 |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[(E)-benzylideneamino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](/N=C/c2ccccc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H25NO9/c1-12(23)27-11-17-18(28-13(2)24)19(29-14(3)25)20(30-15(4)26)21(31-17)22-10-16-8-6-5-7-9-16/h5-10,17-21H,11H2,1-4H3/b22-10+/t17-,18+,19+,20-,21-/m1/s1 |
| InChIKey | YXBOQWLRVBQNBQ-VZEAQAALSA-N |
| XLogP | 1.19 |
| TPSA | 126.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|