C25H30O12 — CID 137395312
ethyl (Z)-3-phenyl-2-[(2S,3R,4S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyprop-2-enoate (PubChem CID 137395312) has the molecular formula C25H30O12 and a molecular weight of 522.50 g/mol. Its IUPAC name is ethyl (Z)-3-phenyl-2-[(2S,3R,4S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyprop-2-enoate.
| Compound Name | ethyl (Z)-3-phenyl-2-[(2S,3R,4S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyprop-2-enoate |
|---|---|
| PubChem CID | 137395312 |
| Molecular Formula | C25H30O12 |
| Molecular Weight | 522.50 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | ethyl (Z)-3-phenyl-2-[(2S,3R,4S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyprop-2-enoate |
| SMILES | CCOC(=O)/C(=C/c1ccccc1)O[C@@H]1O[C@H](COC(C)=O)C(OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C25H30O12/c1-6-31-24(30)19(12-18-10-8-7-9-11-18)36-25-23(35-17(5)29)22(34-16(4)28)21(33-15(3)27)20(37-25)13-32-14(2)26/h7-12,20-23,25H,6,13H2,1-5H3/b19-12-/t20-,21?,22+,23-,25-/m1/s1 |
| InChIKey | PJUCGJZCMHHXLZ-CHCWQCHKSA-N |
| XLogP | 1.69 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.50 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|