C25H29FO12 — CID 66980239
ethyl (Z)-3-(3-fluorophenyl)-2-[(2R,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyprop-2-enoate (PubChem CID 66980239) has the molecular formula C25H29FO12 and a molecular weight of 540.49 g/mol. Its IUPAC name is ethyl (Z)-3-(3-fluorophenyl)-2-[(2R,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyprop-2-enoate.
| Compound Name | ethyl (Z)-3-(3-fluorophenyl)-2-[(2R,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyprop-2-enoate |
|---|---|
| PubChem CID | 66980239 |
| Molecular Formula | C25H29FO12 |
| Molecular Weight | 540.49 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | ethyl (Z)-3-(3-fluorophenyl)-2-[(2R,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyprop-2-enoate |
| SMILES | CCOC(=O)/C(=C/c1cccc(F)c1)O[C@H]1O[C@@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H29FO12/c1-6-32-24(31)19(11-17-8-7-9-18(26)10-17)37-25-23(36-16(5)30)22(35-15(4)29)21(34-14(3)28)20(38-25)12-33-13(2)27/h7-11,20-23,25H,6,12H2,1-5H3/b19-11-/t20-,21+,22+,23-,25-/m0/s1 |
| InChIKey | OUMPHKOLWVVNSF-VWLJQKNYSA-N |
| XLogP | 1.83 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.49 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|