C24H26ClFO12 — CID 77245090
methyl 3-(2-chloro-6-fluorophenyl)-2-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyprop-2-enoate (PubChem CID 77245090) has the molecular formula C24H26ClFO12 and a molecular weight of 560.91 g/mol. Its IUPAC name is methyl 3-(2-chloro-6-fluorophenyl)-2-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyprop-2-enoate.
| Compound Name | methyl 3-(2-chloro-6-fluorophenyl)-2-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyprop-2-enoate |
|---|---|
| PubChem CID | 77245090 |
| Molecular Formula | C24H26ClFO12 |
| Molecular Weight | 560.91 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | methyl 3-(2-chloro-6-fluorophenyl)-2-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyprop-2-enoate |
| SMILES | COC(=O)C(=Cc1c(F)cccc1Cl)OC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C24H26ClFO12/c1-11(27)33-10-19-20(34-12(2)28)21(35-13(3)29)22(36-14(4)30)24(38-19)37-18(23(31)32-5)9-15-16(25)7-6-8-17(15)26/h6-9,19-22,24H,10H2,1-5H3 |
| InChIKey | HIBKEQUCHYXAGS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.91 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|