C22H26O12S — CID 66980333
methyl (Z)-3-thiophen-2-yl-2-[(2R,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyprop-2-enoate (PubChem CID 66980333) has the molecular formula C22H26O12S and a molecular weight of 514.51 g/mol. Its IUPAC name is methyl (Z)-3-thiophen-2-yl-2-[(2R,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyprop-2-enoate.
| Compound Name | methyl (Z)-3-thiophen-2-yl-2-[(2R,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyprop-2-enoate |
|---|---|
| PubChem CID | 66980333 |
| Molecular Formula | C22H26O12S |
| Molecular Weight | 514.51 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | methyl (Z)-3-thiophen-2-yl-2-[(2R,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyprop-2-enoate |
| SMILES | COC(=O)/C(=C/c1cccs1)O[C@H]1O[C@@H](COC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H26O12S/c1-11(23)29-10-17-18(30-12(2)24)19(31-13(3)25)20(32-14(4)26)22(34-17)33-16(21(27)28-5)9-15-7-6-8-35-15/h6-9,17-20,22H,10H2,1-5H3/b16-9-/t17-,18-,19+,20-,22-/m0/s1 |
| InChIKey | TVZYXZIBTHKHMO-KNDBUJANSA-N |
| XLogP | 1.36 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.51 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|