C16H20N2O2 — CID 170894473
1-(4-methoxy-2-phenylmethoxyphenyl)ethane-1,2-diamine (PubChem CID 170894473) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 1-(4-methoxy-2-phenylmethoxyphenyl)ethane-1,2-diamine.
| Compound Name | 1-(4-methoxy-2-phenylmethoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 170894473 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 1-(4-methoxy-2-phenylmethoxyphenyl)ethane-1,2-diamine |
| SMILES | COc1ccc(C(N)CN)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C16H20N2O2/c1-19-13-7-8-14(15(18)10-17)16(9-13)20-11-12-5-3-2-4-6-12/h2-9,15H,10-11,17-18H2,1H3 |
| InChIKey | ZOBSKXRAAJVSJL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |