C19H25NO4 — CID 113341049
1-[2-(1-aminoethyl)-5-methoxyphenoxy]-3-phenylmethoxypropan-2-ol (PubChem CID 113341049) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is 1-[2-(1-aminoethyl)-5-methoxyphenoxy]-3-phenylmethoxypropan-2-ol.
| Compound Name | 1-[2-(1-aminoethyl)-5-methoxyphenoxy]-3-phenylmethoxypropan-2-ol |
|---|---|
| PubChem CID | 113341049 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 1-[2-(1-aminoethyl)-5-methoxyphenoxy]-3-phenylmethoxypropan-2-ol |
| SMILES | COc1ccc(C(C)N)c(OCC(O)COCc2ccccc2)c1 |
| InChI | InChI=1S/C19H25NO4/c1-14(20)18-9-8-17(22-2)10-19(18)24-13-16(21)12-23-11-15-6-4-3-5-7-15/h3-10,14,16,21H,11-13,20H2,1-2H3 |
| InChIKey | VBFOSJUWJZUULO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |