C21H29NO3 — CID 113235681
1-[4-[(2-methylpropylamino)methyl]phenoxy]-3-phenylmethoxypropan-2-ol (PubChem CID 113235681) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-[4-[(2-methylpropylamino)methyl]phenoxy]-3-phenylmethoxypropan-2-ol.
| Compound Name | 1-[4-[(2-methylpropylamino)methyl]phenoxy]-3-phenylmethoxypropan-2-ol |
|---|---|
| PubChem CID | 113235681 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 1-[4-[(2-methylpropylamino)methyl]phenoxy]-3-phenylmethoxypropan-2-ol |
| SMILES | CC(C)CNCc1ccc(OCC(O)COCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H29NO3/c1-17(2)12-22-13-18-8-10-21(11-9-18)25-16-20(23)15-24-14-19-6-4-3-5-7-19/h3-11,17,20,22-23H,12-16H2,1-2H3 |
| InChIKey | HUJKXVHSHFEOBJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |