C20H28ClNO2 — CID 10405576
1-(benzylamino)-3-(4-tert-butylphenoxy)propan-2-ol;hydrochloride (PubChem CID 10405576) has the molecular formula C20H28ClNO2 and a molecular weight of 349.90 g/mol. Its IUPAC name is 1-(benzylamino)-3-(4-tert-butylphenoxy)propan-2-ol;hydrochloride.
| Compound Name | 1-(benzylamino)-3-(4-tert-butylphenoxy)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 10405576 |
| Molecular Formula | C20H28ClNO2 |
| Molecular Weight | 349.90 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 1-(benzylamino)-3-(4-tert-butylphenoxy)propan-2-ol;hydrochloride |
| SMILES | CC(C)(C)c1ccc(OCC(O)CNCc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C20H27NO2.ClH/c1-20(2,3)17-9-11-19(12-10-17)23-15-18(22)14-21-13-16-7-5-4-6-8-16;/h4-12,18,21-22H,13-15H2,1-3H3;1H |
| InChIKey | BRYNQHCNEZNVLI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.90 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |