C26H39NO2 — CID 4149614
1-(benzylamino)-3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propan-2-ol (PubChem CID 4149614) has the molecular formula C26H39NO2 and a molecular weight of 397.60 g/mol. Its IUPAC name is 1-(benzylamino)-3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propan-2-ol.
| Compound Name | 1-(benzylamino)-3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 4149614 |
| Molecular Formula | C26H39NO2 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.30 |
| IUPAC Name | 1-(benzylamino)-3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propan-2-ol |
| SMILES | CCC(C)(C)c1ccc(OCC(O)CNCc2ccccc2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C26H39NO2/c1-7-25(3,4)21-14-15-24(23(16-21)26(5,6)8-2)29-19-22(28)18-27-17-20-12-10-9-11-13-20/h9-16,22,27-28H,7-8,17-19H2,1-6H3 |
| InChIKey | ZSDQEHNBICRVES-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |