C23H39NO3 — CID 2932840
1-[2,4-bis(2-methylbutan-2-yl)phenoxy]-3-morpholin-4-ylpropan-2-ol (PubChem CID 2932840) has the molecular formula C23H39NO3 and a molecular weight of 377.57 g/mol. Its IUPAC name is 1-[2,4-bis(2-methylbutan-2-yl)phenoxy]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | 1-[2,4-bis(2-methylbutan-2-yl)phenoxy]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 2932840 |
| Molecular Formula | C23H39NO3 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.29 |
| IUPAC Name | 1-[2,4-bis(2-methylbutan-2-yl)phenoxy]-3-morpholin-4-ylpropan-2-ol |
| SMILES | CCC(C)(C)c1ccc(OCC(O)CN2CCOCC2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C23H39NO3/c1-7-22(3,4)18-9-10-21(20(15-18)23(5,6)8-2)27-17-19(25)16-24-11-13-26-14-12-24/h9-10,15,19,25H,7-8,11-14,16-17H2,1-6H3 |
| InChIKey | PHORGQHWYHUUKN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |