C26H35BrClNO4 — CID 158411880
(2S)-1-[4-[2-[3-bromo-4-[(2S)-3-chloro-2-methylpropoxy]phenyl]propan-2-yl]phenoxy]-3-morpholin-4-ylpropan-2-ol (PubChem CID 158411880) has the molecular formula C26H35BrClNO4 and a molecular weight of 540.93 g/mol. Its IUPAC name is (2S)-1-[4-[2-[3-bromo-4-[(2S)-3-chloro-2-methylpropoxy]phenyl]propan-2-yl]phenoxy]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | (2S)-1-[4-[2-[3-bromo-4-[(2S)-3-chloro-2-methylpropoxy]phenyl]propan-2-yl]phenoxy]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 158411880 |
| Molecular Formula | C26H35BrClNO4 |
| Molecular Weight | 540.93 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | (2S)-1-[4-[2-[3-bromo-4-[(2S)-3-chloro-2-methylpropoxy]phenyl]propan-2-yl]phenoxy]-3-morpholin-4-ylpropan-2-ol |
| SMILES | C[C@H](CCl)COc1ccc(C(C)(C)c2ccc(OC[C@@H](O)CN3CCOCC3)cc2)cc1Br |
| InChI | InChI=1S/C26H35BrClNO4/c1-19(15-28)17-33-25-9-6-21(14-24(25)27)26(2,3)20-4-7-23(8-5-20)32-18-22(30)16-29-10-12-31-13-11-29/h4-9,14,19,22,30H,10-13,15-18H2,1-3H3/t19-,22+/m1/s1 |
| InChIKey | BXLYILGBDSPKMQ-KNQAVFIVSA-N |
| XLogP | 5.10 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.93 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|