C25H33ClINO5 — CID 135375856
(2S)-1-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]-3-iodophenyl]propan-2-yl]phenoxy]-3-morpholin-4-ylpropan-2-ol (PubChem CID 135375856) has the molecular formula C25H33ClINO5 and a molecular weight of 589.90 g/mol. Its IUPAC name is (2S)-1-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]-3-iodophenyl]propan-2-yl]phenoxy]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | (2S)-1-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]-3-iodophenyl]propan-2-yl]phenoxy]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 135375856 |
| Molecular Formula | C25H33ClINO5 |
| Molecular Weight | 589.90 g/mol |
| Exact Mass | 589.11 |
| IUPAC Name | (2S)-1-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]-3-iodophenyl]propan-2-yl]phenoxy]-3-morpholin-4-ylpropan-2-ol |
| SMILES | CC(C)(c1ccc(OC[C@@H](O)CN2CCOCC2)cc1)c1ccc(OC[C@H](O)CCl)c(I)c1 |
| InChI | InChI=1S/C25H33ClINO5/c1-25(2,19-5-8-24(23(27)13-19)33-16-20(29)14-26)18-3-6-22(7-4-18)32-17-21(30)15-28-9-11-31-12-10-28/h3-8,13,20-21,29-30H,9-12,14-17H2,1-2H3/t20-,21+/m1/s1 |
| InChIKey | BXKFCUCGAPQEGF-RTWAWAEBSA-N |
| XLogP | 3.67 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.90 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|