C25H30ClIN2O5 — CID 122418382
(2S)-1-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]-3-iodophenyl]propan-2-yl]phenoxy]-3-[5-(hydroxymethyl)pyrazol-1-yl]propan-2-ol (PubChem CID 122418382) has the molecular formula C25H30ClIN2O5 and a molecular weight of 600.88 g/mol. Its IUPAC name is (2S)-1-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]-3-iodophenyl]propan-2-yl]phenoxy]-3-[5-(hydroxymethyl)pyrazol-1-yl]propan-2-ol.
| Compound Name | (2S)-1-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]-3-iodophenyl]propan-2-yl]phenoxy]-3-[5-(hydroxymethyl)pyrazol-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 122418382 |
| Molecular Formula | C25H30ClIN2O5 |
| Molecular Weight | 600.88 g/mol |
| Exact Mass | 600.09 |
| IUPAC Name | (2S)-1-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]-3-iodophenyl]propan-2-yl]phenoxy]-3-[5-(hydroxymethyl)pyrazol-1-yl]propan-2-ol |
| SMILES | CC(C)(c1ccc(OC[C@@H](O)Cn2nccc2CO)cc1)c1ccc(OC[C@H](O)CCl)c(I)c1 |
| InChI | InChI=1S/C25H30ClIN2O5/c1-25(2,18-5-8-24(23(27)11-18)34-15-20(31)12-26)17-3-6-22(7-4-17)33-16-21(32)13-29-19(14-30)9-10-28-29/h3-11,20-21,30-32H,12-16H2,1-2H3/t20-,21+/m1/s1 |
| InChIKey | HOTWCCZETXVUFN-RTWAWAEBSA-N |
| XLogP | 3.72 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.88 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|