C26H36Cl2N2O3 — CID 161200221
(2S)-1-[4-[2-[3-chloro-4-[(2S)-3-chloro-2-methylpropoxy]phenyl]propan-2-yl]phenoxy]-3-piperazin-1-ylpropan-2-ol (PubChem CID 161200221) has the molecular formula C26H36Cl2N2O3 and a molecular weight of 495.49 g/mol. Its IUPAC name is (2S)-1-[4-[2-[3-chloro-4-[(2S)-3-chloro-2-methylpropoxy]phenyl]propan-2-yl]phenoxy]-3-piperazin-1-ylpropan-2-ol.
| Compound Name | (2S)-1-[4-[2-[3-chloro-4-[(2S)-3-chloro-2-methylpropoxy]phenyl]propan-2-yl]phenoxy]-3-piperazin-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 161200221 |
| Molecular Formula | C26H36Cl2N2O3 |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | (2S)-1-[4-[2-[3-chloro-4-[(2S)-3-chloro-2-methylpropoxy]phenyl]propan-2-yl]phenoxy]-3-piperazin-1-ylpropan-2-ol |
| SMILES | C[C@H](CCl)COc1ccc(C(C)(C)c2ccc(OC[C@@H](O)CN3CCNCC3)cc2)cc1Cl |
| InChI | InChI=1S/C26H36Cl2N2O3/c1-19(15-27)17-33-25-9-6-21(14-24(25)28)26(2,3)20-4-7-23(8-5-20)32-18-22(31)16-30-12-10-29-11-13-30/h4-9,14,19,22,29,31H,10-13,15-18H2,1-3H3/t19-,22+/m1/s1 |
| InChIKey | CTEHNZJNZVTOFQ-KNQAVFIVSA-N |
| XLogP | 4.56 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|