C31H52N2O3 — CID 145119518
1-[4-[2-(4-butoxy-3-methylphenyl)propan-2-yl]phenoxy]-3-piperazin-1-ylpropan-2-ol;ethane (PubChem CID 145119518) has the molecular formula C31H52N2O3 and a molecular weight of 500.77 g/mol. Its IUPAC name is 1-[4-[2-(4-butoxy-3-methylphenyl)propan-2-yl]phenoxy]-3-piperazin-1-ylpropan-2-ol;ethane.
| Compound Name | 1-[4-[2-(4-butoxy-3-methylphenyl)propan-2-yl]phenoxy]-3-piperazin-1-ylpropan-2-ol;ethane |
|---|---|
| PubChem CID | 145119518 |
| Molecular Formula | C31H52N2O3 |
| Molecular Weight | 500.77 g/mol |
| Exact Mass | 500.40 |
| IUPAC Name | 1-[4-[2-(4-butoxy-3-methylphenyl)propan-2-yl]phenoxy]-3-piperazin-1-ylpropan-2-ol;ethane |
| SMILES | CC.CC.CCCCOc1ccc(C(C)(C)c2ccc(OCC(O)CN3CCNCC3)cc2)cc1C |
| InChI | InChI=1S/C27H40N2O3.2C2H6/c1-5-6-17-31-26-12-9-23(18-21(26)2)27(3,4)22-7-10-25(11-8-22)32-20-24(30)19-29-15-13-28-14-16-29;2*1-2/h7-12,18,24,28,30H,5-6,13-17,19-20H2,1-4H3;2*1-2H3 |
| InChIKey | DUXIBNSFCGLIQV-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.77 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|