C23H27F4NO3 — CID 72720826
1-(aziridin-1-yl)-3-[4-[2-[4-(2,3,3,3-tetrafluoropropoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol (PubChem CID 72720826) has the molecular formula C23H27F4NO3 and a molecular weight of 441.47 g/mol. Its IUPAC name is 1-(aziridin-1-yl)-3-[4-[2-[4-(2,3,3,3-tetrafluoropropoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol.
| Compound Name | 1-(aziridin-1-yl)-3-[4-[2-[4-(2,3,3,3-tetrafluoropropoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 72720826 |
| Molecular Formula | C23H27F4NO3 |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 1-(aziridin-1-yl)-3-[4-[2-[4-(2,3,3,3-tetrafluoropropoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol |
| SMILES | CC(C)(c1ccc(OCC(O)CN2CC2)cc1)c1ccc(OCC(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H27F4NO3/c1-22(2,17-5-9-20(10-6-17)31-15-21(24)23(25,26)27)16-3-7-19(8-4-16)30-14-18(29)13-28-11-12-28/h3-10,18,21,29H,11-15H2,1-2H3 |
| InChIKey | RBSKDGIIZWEFLO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 41.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|