C26H40NO2+ — CID 91670409
benzyl-[3-(2,4-ditert-butylphenoxy)-2-hydroxypropyl]-dimethylazanium (PubChem CID 91670409) has the molecular formula C26H40NO2+ and a molecular weight of 398.61 g/mol. Its IUPAC name is benzyl-[3-(2,4-ditert-butylphenoxy)-2-hydroxypropyl]-dimethylazanium.
| Compound Name | benzyl-[3-(2,4-ditert-butylphenoxy)-2-hydroxypropyl]-dimethylazanium |
|---|---|
| PubChem CID | 91670409 |
| Molecular Formula | C26H40NO2+ |
| Molecular Weight | 398.61 g/mol |
| Exact Mass | 398.31 |
| IUPAC Name | benzyl-[3-(2,4-ditert-butylphenoxy)-2-hydroxypropyl]-dimethylazanium |
| SMILES | CC(C)(C)c1ccc(OCC(O)C[N+](C)(C)Cc2ccccc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H40NO2/c1-25(2,3)21-14-15-24(23(16-21)26(4,5)6)29-19-22(28)18-27(7,8)17-20-12-10-9-11-13-20/h9-16,22,28H,17-19H2,1-8H3/q+1 |
| InChIKey | BLRWYJVQOCQVTJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.61 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|