C29H46NO3+ — CID 91670395
[3-[2-(2,4-ditert-butylphenoxy)ethoxy]-2-hydroxypropyl]-dimethyl-[(4-methylphenyl)methyl]azanium (PubChem CID 91670395) has the molecular formula C29H46NO3+ and a molecular weight of 456.69 g/mol. Its IUPAC name is [3-[2-(2,4-ditert-butylphenoxy)ethoxy]-2-hydroxypropyl]-dimethyl-[(4-methylphenyl)methyl]azanium.
| Compound Name | [3-[2-(2,4-ditert-butylphenoxy)ethoxy]-2-hydroxypropyl]-dimethyl-[(4-methylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 91670395 |
| Molecular Formula | C29H46NO3+ |
| Molecular Weight | 456.69 g/mol |
| Exact Mass | 456.35 |
| IUPAC Name | [3-[2-(2,4-ditert-butylphenoxy)ethoxy]-2-hydroxypropyl]-dimethyl-[(4-methylphenyl)methyl]azanium |
| SMILES | Cc1ccc(C[N+](C)(C)CC(O)COCCOc2ccc(C(C)(C)C)cc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H46NO3/c1-22-10-12-23(13-11-22)19-30(8,9)20-25(31)21-32-16-17-33-27-15-14-24(28(2,3)4)18-26(27)29(5,6)7/h10-15,18,25,31H,16-17,19-21H2,1-9H3/q+1 |
| InChIKey | UBKBWXHKDJPUNV-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.69 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|