C34H47Br2NO3 — CID 177328630
[4-[(3-bromophenyl)methoxy]phenyl]methyl-[2-[2-(2,4-ditert-butylphenoxy)ethoxy]ethyl]-dimethylazanium bromide (PubChem CID 177328630) has the molecular formula C34H47Br2NO3 and a molecular weight of 677.56 g/mol. Its IUPAC name is [4-[(3-bromophenyl)methoxy]phenyl]methyl-[2-[2-(2,4-ditert-butylphenoxy)ethoxy]ethyl]-dimethylazanium bromide.
| Compound Name | [4-[(3-bromophenyl)methoxy]phenyl]methyl-[2-[2-(2,4-ditert-butylphenoxy)ethoxy]ethyl]-dimethylazanium bromide |
|---|---|
| PubChem CID | 177328630 |
| Molecular Formula | C34H47Br2NO3 |
| Molecular Weight | 677.56 g/mol |
| Exact Mass | 675.19 |
| IUPAC Name | [4-[(3-bromophenyl)methoxy]phenyl]methyl-[2-[2-(2,4-ditert-butylphenoxy)ethoxy]ethyl]-dimethylazanium bromide |
| SMILES | CC(C)(C)c1ccc(OCCOCC[N+](C)(C)Cc2ccc(OCc3cccc(Br)c3)cc2)c(C(C)(C)C)c1.[Br-] |
| InChI | InChI=1S/C34H47BrNO3.BrH/c1-33(2,3)28-14-17-32(31(23-28)34(4,5)6)38-21-20-37-19-18-36(7,8)24-26-12-15-30(16-13-26)39-25-27-10-9-11-29(35)22-27;/h9-17,22-23H,18-21,24-25H2,1-8H3;1H/q+1;/p-1 |
| InChIKey | HKWLYLLYISNFCV-UHFFFAOYSA-M |
| XLogP | 5.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.56 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|