C28H43FNO3+ — CID 100798450
[(2S)-3-[2-(2,4-ditert-butylphenoxy)ethoxy]-2-hydroxypropyl]-[(4-fluorophenyl)methyl]-dimethylazanium (PubChem CID 100798450) has the molecular formula C28H43FNO3+ and a molecular weight of 460.65 g/mol. Its IUPAC name is [(2S)-3-[2-(2,4-ditert-butylphenoxy)ethoxy]-2-hydroxypropyl]-[(4-fluorophenyl)methyl]-dimethylazanium.
| Compound Name | [(2S)-3-[2-(2,4-ditert-butylphenoxy)ethoxy]-2-hydroxypropyl]-[(4-fluorophenyl)methyl]-dimethylazanium |
|---|---|
| PubChem CID | 100798450 |
| Molecular Formula | C28H43FNO3+ |
| Molecular Weight | 460.65 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | [(2S)-3-[2-(2,4-ditert-butylphenoxy)ethoxy]-2-hydroxypropyl]-[(4-fluorophenyl)methyl]-dimethylazanium |
| SMILES | CC(C)(C)c1ccc(OCCOC[C@@H](O)C[N+](C)(C)Cc2ccc(F)cc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H43FNO3/c1-27(2,3)22-11-14-26(25(17-22)28(4,5)6)33-16-15-32-20-24(31)19-30(7,8)18-21-9-12-23(29)13-10-21/h9-14,17,24,31H,15-16,18-20H2,1-8H3/q+1/t24-/m0/s1 |
| InChIKey | NHNUGWJDVFCBSD-DEOSSOPVSA-N |
| XLogP | 5.45 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.65 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|