C26H45NO3 — CID 100798495
(2R)-1-[2-(2,4-ditert-butylphenoxy)ethoxy]-3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-ol (PubChem CID 100798495) has the molecular formula C26H45NO3 and a molecular weight of 419.65 g/mol. Its IUPAC name is (2R)-1-[2-(2,4-ditert-butylphenoxy)ethoxy]-3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-ol.
| Compound Name | (2R)-1-[2-(2,4-ditert-butylphenoxy)ethoxy]-3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 100798495 |
| Molecular Formula | C26H45NO3 |
| Molecular Weight | 419.65 g/mol |
| Exact Mass | 419.34 |
| IUPAC Name | (2R)-1-[2-(2,4-ditert-butylphenoxy)ethoxy]-3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-ol |
| SMILES | C[C@@H]1C[C@@H](C)CN(C[C@@H](O)COCCOc2ccc(C(C)(C)C)cc2C(C)(C)C)C1 |
| InChI | InChI=1S/C26H45NO3/c1-19-13-20(2)16-27(15-19)17-22(28)18-29-11-12-30-24-10-9-21(25(3,4)5)14-23(24)26(6,7)8/h9-10,14,19-20,22,28H,11-13,15-18H2,1-8H3/t19-,20-,22-/m1/s1 |
| InChIKey | OVAHSFANFACHDY-KCZVDYSFSA-N |
| XLogP | 5.02 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.65 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|