C32H50NO3+ — CID 100798404
(2R)-1-(1-benzyl-4-methylpiperidin-1-ium-1-yl)-3-[2-(2,4-ditert-butylphenoxy)ethoxy]propan-2-ol (PubChem CID 100798404) has the molecular formula C32H50NO3+ and a molecular weight of 496.76 g/mol. Its IUPAC name is (2R)-1-(1-benzyl-4-methylpiperidin-1-ium-1-yl)-3-[2-(2,4-ditert-butylphenoxy)ethoxy]propan-2-ol.
| Compound Name | (2R)-1-(1-benzyl-4-methylpiperidin-1-ium-1-yl)-3-[2-(2,4-ditert-butylphenoxy)ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 100798404 |
| Molecular Formula | C32H50NO3+ |
| Molecular Weight | 496.76 g/mol |
| Exact Mass | 496.38 |
| IUPAC Name | (2R)-1-(1-benzyl-4-methylpiperidin-1-ium-1-yl)-3-[2-(2,4-ditert-butylphenoxy)ethoxy]propan-2-ol |
| SMILES | CC1CC[N+](Cc2ccccc2)(C[C@@H](O)COCCOc2ccc(C(C)(C)C)cc2C(C)(C)C)CC1 |
| InChI | InChI=1S/C32H50NO3/c1-25-15-17-33(18-16-25,22-26-11-9-8-10-12-26)23-28(34)24-35-19-20-36-30-14-13-27(31(2,3)4)21-29(30)32(5,6)7/h8-14,21,25,28,34H,15-20,22-24H2,1-7H3/q+1/t25?,28-,33?/m1/s1 |
| InChIKey | UDENERIYCZQOBQ-SDBCIHFPSA-N |
| XLogP | 6.48 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.76 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|