C36H50O8 — CID 139335896
4-tert-butyl-1,2-bis[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]benzene (PubChem CID 139335896) has the molecular formula C36H50O8 and a molecular weight of 610.79 g/mol. Its IUPAC name is 4-tert-butyl-1,2-bis[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]benzene.
| Compound Name | 4-tert-butyl-1,2-bis[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]benzene |
|---|---|
| PubChem CID | 139335896 |
| Molecular Formula | C36H50O8 |
| Molecular Weight | 610.79 g/mol |
| Exact Mass | 610.35 |
| IUPAC Name | 4-tert-butyl-1,2-bis[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]benzene |
| SMILES | CC(C)(C)c1ccc(OCCOCCOCCOCc2ccccc2)c(OCCOCCOCCOCc2ccccc2)c1 |
| InChI | InChI=1S/C36H50O8/c1-36(2,3)33-14-15-34(43-26-24-39-18-16-37-20-22-41-29-31-10-6-4-7-11-31)35(28-33)44-27-25-40-19-17-38-21-23-42-30-32-12-8-5-9-13-32/h4-15,28H,16-27,29-30H2,1-3H3 |
| InChIKey | AQZVMRDYGLIZGC-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.79 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|