C16H24Cl2O2 — CID 13295778
4-tert-butyl-1,2-bis(3-chloropropoxy)benzene (PubChem CID 13295778) has the molecular formula C16H24Cl2O2 and a molecular weight of 319.27 g/mol. Its IUPAC name is 4-tert-butyl-1,2-bis(3-chloropropoxy)benzene.
| Compound Name | 4-tert-butyl-1,2-bis(3-chloropropoxy)benzene |
|---|---|
| PubChem CID | 13295778 |
| Molecular Formula | C16H24Cl2O2 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 4-tert-butyl-1,2-bis(3-chloropropoxy)benzene |
| SMILES | CC(C)(C)c1ccc(OCCCCl)c(OCCCCl)c1 |
| InChI | InChI=1S/C16H24Cl2O2/c1-16(2,3)13-6-7-14(19-10-4-8-17)15(12-13)20-11-5-9-18/h6-7,12H,4-5,8-11H2,1-3H3 |
| InChIKey | MIJKJBVOGVHEAD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|