C15H23F2NO2 — CID 80605959
2-(3,4-dipropoxyphenyl)-1,1-difluoropropan-2-amine (PubChem CID 80605959) has the molecular formula C15H23F2NO2 and a molecular weight of 287.35 g/mol. Its IUPAC name is 2-(3,4-dipropoxyphenyl)-1,1-difluoropropan-2-amine.
| Compound Name | 2-(3,4-dipropoxyphenyl)-1,1-difluoropropan-2-amine |
|---|---|
| PubChem CID | 80605959 |
| Molecular Formula | C15H23F2NO2 |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 2-(3,4-dipropoxyphenyl)-1,1-difluoropropan-2-amine |
| SMILES | CCCOc1ccc(C(C)(N)C(F)F)cc1OCCC |
| InChI | InChI=1S/C15H23F2NO2/c1-4-8-19-12-7-6-11(15(3,18)14(16)17)10-13(12)20-9-5-2/h6-7,10,14H,4-5,8-9,18H2,1-3H3 |
| InChIKey | SXQNIFVTRZKBKT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |