C12H18O2S — CID 28939740
3,4-dipropoxybenzenethiol (PubChem CID 28939740) has the molecular formula C12H18O2S and a molecular weight of 226.34 g/mol. Its IUPAC name is 3,4-dipropoxybenzenethiol.
| Compound Name | 3,4-dipropoxybenzenethiol |
|---|---|
| PubChem CID | 28939740 |
| Molecular Formula | C12H18O2S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 3,4-dipropoxybenzenethiol |
| SMILES | CCCOc1ccc(S)cc1OCCC |
| InChI | InChI=1S/C12H18O2S/c1-3-7-13-11-6-5-10(15)9-12(11)14-8-4-2/h5-6,9,15H,3-4,7-8H2,1-2H3 |
| InChIKey | PBMLWAOOCUAUJY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|