C18H30OS — CID 70397039
4-butoxy-3-(2,4,4-trimethylpentan-2-yl)benzenethiol (PubChem CID 70397039) has the molecular formula C18H30OS and a molecular weight of 294.50 g/mol. Its IUPAC name is 4-butoxy-3-(2,4,4-trimethylpentan-2-yl)benzenethiol.
| Compound Name | 4-butoxy-3-(2,4,4-trimethylpentan-2-yl)benzenethiol |
|---|---|
| PubChem CID | 70397039 |
| Molecular Formula | C18H30OS |
| Molecular Weight | 294.50 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 4-butoxy-3-(2,4,4-trimethylpentan-2-yl)benzenethiol |
| SMILES | CCCCOc1ccc(S)cc1C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C18H30OS/c1-7-8-11-19-16-10-9-14(20)12-15(16)18(5,6)13-17(2,3)4/h9-10,12,20H,7-8,11,13H2,1-6H3 |
| InChIKey | WNUAKOTVRYXGMQ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.50 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|