C69H117O3P — CID 20502058
tris[4-nonyl-2-(2,4,4-trimethylpentan-2-yl)phenyl] phosphite (PubChem CID 20502058) has the molecular formula C69H117O3P and a molecular weight of 1025.67 g/mol. Its IUPAC name is tris[4-nonyl-2-(2,4,4-trimethylpentan-2-yl)phenyl] phosphite.
| Compound Name | tris[4-nonyl-2-(2,4,4-trimethylpentan-2-yl)phenyl] phosphite |
|---|---|
| PubChem CID | 20502058 |
| Molecular Formula | C69H117O3P |
| Molecular Weight | 1025.67 g/mol |
| Exact Mass | 1024.87 |
| IUPAC Name | tris[4-nonyl-2-(2,4,4-trimethylpentan-2-yl)phenyl] phosphite |
| SMILES | CCCCCCCCCc1ccc(OP(Oc2ccc(CCCCCCCCC)cc2C(C)(C)CC(C)(C)C)Oc2ccc(CCCCCCCCC)cc2C(C)(C)CC(C)(C)C)c(C(C)(C)CC(C)(C)C)c1 |
| InChI | InChI=1S/C69H117O3P/c1-19-22-25-28-31-34-37-40-55-43-46-61(58(49-55)67(13,14)52-64(4,5)6)70-73(71-62-47-44-56(41-38-35-32-29-26-23-20-2)50-59(62)68(15,16)53-65(7,8)9)72-63-48-45-57(42-39-36-33-30-27-24-21-3)51-60(63)69(17,18)54-66(10,11)12/h43-51H,19-42,52-54H2,1-18H3 |
| InChIKey | VOOQOODIGGUKCG-UHFFFAOYSA-N |
| XLogP | 23.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1025.67 |
| LogP ≤ 5 | 23.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|