C38H70O2 — CID 71404525
1,4-dioctoxy-2,5-bis(2,4,4-trimethylpentan-2-yl)benzene (PubChem CID 71404525) has the molecular formula C38H70O2 and a molecular weight of 558.98 g/mol. Its IUPAC name is 1,4-dioctoxy-2,5-bis(2,4,4-trimethylpentan-2-yl)benzene.
| Compound Name | 1,4-dioctoxy-2,5-bis(2,4,4-trimethylpentan-2-yl)benzene |
|---|---|
| PubChem CID | 71404525 |
| Molecular Formula | C38H70O2 |
| Molecular Weight | 558.98 g/mol |
| Exact Mass | 558.54 |
| IUPAC Name | 1,4-dioctoxy-2,5-bis(2,4,4-trimethylpentan-2-yl)benzene |
| SMILES | CCCCCCCCOc1cc(C(C)(C)CC(C)(C)C)c(OCCCCCCCC)cc1C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C38H70O2/c1-13-15-17-19-21-23-25-39-33-27-32(38(11,12)30-36(6,7)8)34(40-26-24-22-20-18-16-14-2)28-31(33)37(9,10)29-35(3,4)5/h27-28H,13-26,29-30H2,1-12H3 |
| InChIKey | VHRGFQBZOWVSPJ-UHFFFAOYSA-N |
| XLogP | 12.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.98 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|