C23H40O — CID 20589144
2-methyl-1-octoxy-4-(2,4,4-trimethylpentan-2-yl)benzene (PubChem CID 20589144) has the molecular formula C23H40O and a molecular weight of 332.57 g/mol. Its IUPAC name is 2-methyl-1-octoxy-4-(2,4,4-trimethylpentan-2-yl)benzene.
| Compound Name | 2-methyl-1-octoxy-4-(2,4,4-trimethylpentan-2-yl)benzene |
|---|---|
| PubChem CID | 20589144 |
| Molecular Formula | C23H40O |
| Molecular Weight | 332.57 g/mol |
| Exact Mass | 332.31 |
| IUPAC Name | 2-methyl-1-octoxy-4-(2,4,4-trimethylpentan-2-yl)benzene |
| SMILES | CCCCCCCCOc1ccc(C(C)(C)CC(C)(C)C)cc1C |
| InChI | InChI=1S/C23H40O/c1-8-9-10-11-12-13-16-24-21-15-14-20(17-19(21)2)23(6,7)18-22(3,4)5/h14-15,17H,8-13,16,18H2,1-7H3 |
| InChIKey | RXRYSMVJNQVMIJ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.57 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|