C17H30NO+ — CID 2580791
butyl-[2-(4-tert-butyl-2-methylphenoxy)ethyl]azanium (PubChem CID 2580791) has the molecular formula C17H30NO+ and a molecular weight of 264.43 g/mol. Its IUPAC name is butyl-[2-(4-tert-butyl-2-methylphenoxy)ethyl]azanium.
| Compound Name | butyl-[2-(4-tert-butyl-2-methylphenoxy)ethyl]azanium |
|---|---|
| PubChem CID | 2580791 |
| Molecular Formula | C17H30NO+ |
| Molecular Weight | 264.43 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | butyl-[2-(4-tert-butyl-2-methylphenoxy)ethyl]azanium |
| SMILES | CCCC[NH2+]CCOc1ccc(C(C)(C)C)cc1C |
| InChI | InChI=1S/C17H29NO/c1-6-7-10-18-11-12-19-16-9-8-15(13-14(16)2)17(3,4)5/h8-9,13,18H,6-7,10-12H2,1-5H3/p+1 |
| InChIKey | DPWBEDVXDMGFNI-UHFFFAOYSA-O |
| XLogP | 3.03 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|