C22H39NO — CID 71406023
2-butoxy-N,N-dibutyl-5-tert-butylaniline (PubChem CID 71406023) has the molecular formula C22H39NO and a molecular weight of 333.56 g/mol. Its IUPAC name is 2-butoxy-N,N-dibutyl-5-tert-butylaniline.
| Compound Name | 2-butoxy-N,N-dibutyl-5-tert-butylaniline |
|---|---|
| PubChem CID | 71406023 |
| Molecular Formula | C22H39NO |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 333.30 |
| IUPAC Name | 2-butoxy-N,N-dibutyl-5-tert-butylaniline |
| SMILES | CCCCOc1ccc(C(C)(C)C)cc1N(CCCC)CCCC |
| InChI | InChI=1S/C22H39NO/c1-7-10-15-23(16-11-8-2)20-18-19(22(4,5)6)13-14-21(20)24-17-12-9-3/h13-14,18H,7-12,15-17H2,1-6H3 |
| InChIKey | CJIQFBKXHZQXSH-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|