C18H30F6N3OP — CID 19760814
2-butoxy-4-(dibutylamino)benzenediazonium hexafluorophosphate (PubChem CID 19760814) has the molecular formula C18H30F6N3OP and a molecular weight of 449.42 g/mol. Its IUPAC name is 2-butoxy-4-(dibutylamino)benzenediazonium hexafluorophosphate.
| Compound Name | 2-butoxy-4-(dibutylamino)benzenediazonium hexafluorophosphate |
|---|---|
| PubChem CID | 19760814 |
| Molecular Formula | C18H30F6N3OP |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 2-butoxy-4-(dibutylamino)benzenediazonium hexafluorophosphate |
| SMILES | CCCCOc1cc(N(CCCC)CCCC)ccc1[N+]#N.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C18H30N3O.F6P/c1-4-7-12-21(13-8-5-2)16-10-11-17(20-19)18(15-16)22-14-9-6-3;1-7(2,3,4,5)6/h10-11,15H,4-9,12-14H2,1-3H3;/q+1;-1 |
| InChIKey | IONZAIMRJCLMNP-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|