C44H66N6O2 — CID 102203350
(E)-2,3-bis[[4-(dibutylamino)-2-pentoxyphenyl]methylideneamino]but-2-enedinitrile (PubChem CID 102203350) has the molecular formula C44H66N6O2 and a molecular weight of 711.05 g/mol. Its IUPAC name is (E)-2,3-bis[[4-(dibutylamino)-2-pentoxyphenyl]methylideneamino]but-2-enedinitrile.
| Compound Name | (E)-2,3-bis[[4-(dibutylamino)-2-pentoxyphenyl]methylideneamino]but-2-enedinitrile |
|---|---|
| PubChem CID | 102203350 |
| Molecular Formula | C44H66N6O2 |
| Molecular Weight | 711.05 g/mol |
| Exact Mass | 710.52 |
| IUPAC Name | (E)-2,3-bis[[4-(dibutylamino)-2-pentoxyphenyl]methylideneamino]but-2-enedinitrile |
| SMILES | CCCCCOc1cc(N(CCCC)CCCC)ccc1/C=N/C(C#N)=C(C#N)/N=C/c1ccc(N(CCCC)CCCC)cc1OCCCCC |
| InChI | InChI=1S/C44H66N6O2/c1-7-13-19-29-51-43-31-39(49(25-15-9-3)26-16-10-4)23-21-37(43)35-47-41(33-45)42(34-46)48-36-38-22-24-40(32-44(38)52-30-20-14-8-2)50(27-17-11-5)28-18-12-6/h21-24,31-32,35-36H,7-20,25-30H2,1-6H3/b42-41+,47-35+,48-36+ |
| InChIKey | MPWSVVHPODQFDU-AOUAWGSXSA-N |
| XLogP | 11.43 |
| TPSA | 97.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.05 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|