C36H50N6O2 — CID 102203348
(E)-2,3-bis[[4-(dibutylamino)-2-methoxyphenyl]methylideneamino]but-2-enedinitrile (PubChem CID 102203348) has the molecular formula C36H50N6O2 and a molecular weight of 598.84 g/mol. Its IUPAC name is (E)-2,3-bis[[4-(dibutylamino)-2-methoxyphenyl]methylideneamino]but-2-enedinitrile.
| Compound Name | (E)-2,3-bis[[4-(dibutylamino)-2-methoxyphenyl]methylideneamino]but-2-enedinitrile |
|---|---|
| PubChem CID | 102203348 |
| Molecular Formula | C36H50N6O2 |
| Molecular Weight | 598.84 g/mol |
| Exact Mass | 598.40 |
| IUPAC Name | (E)-2,3-bis[[4-(dibutylamino)-2-methoxyphenyl]methylideneamino]but-2-enedinitrile |
| SMILES | CCCCN(CCCC)c1ccc(/C=N/C(C#N)=C(C#N)/N=C/c2ccc(N(CCCC)CCCC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C36H50N6O2/c1-7-11-19-41(20-12-8-2)31-17-15-29(35(23-31)43-5)27-39-33(25-37)34(26-38)40-28-30-16-18-32(24-36(30)44-6)42(21-13-9-3)22-14-10-4/h15-18,23-24,27-28H,7-14,19-22H2,1-6H3/b34-33+,39-27+,40-28+ |
| InChIKey | PGQMJZZLMPHQOY-KDYAZTCUSA-N |
| XLogP | 8.31 |
| TPSA | 97.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.84 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|