C32H34N4O2 — CID 88856805
2-[3-cyano-4-[(E)-2-[4-(dibutylamino)-2-methoxyphenyl]ethenyl]-5-methyl-5-phenylfuran-2-ylidene]propanedinitrile (PubChem CID 88856805) has the molecular formula C32H34N4O2 and a molecular weight of 506.65 g/mol. Its IUPAC name is 2-[3-cyano-4-[(E)-2-[4-(dibutylamino)-2-methoxyphenyl]ethenyl]-5-methyl-5-phenylfuran-2-ylidene]propanedinitrile.
| Compound Name | 2-[3-cyano-4-[(E)-2-[4-(dibutylamino)-2-methoxyphenyl]ethenyl]-5-methyl-5-phenylfuran-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 88856805 |
| Molecular Formula | C32H34N4O2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | 2-[3-cyano-4-[(E)-2-[4-(dibutylamino)-2-methoxyphenyl]ethenyl]-5-methyl-5-phenylfuran-2-ylidene]propanedinitrile |
| SMILES | CCCCN(CCCC)c1ccc(/C=C/C2=C(C#N)C(=C(C#N)C#N)OC2(C)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C32H34N4O2/c1-5-7-18-36(19-8-6-2)27-16-14-24(30(20-27)37-4)15-17-29-28(23-35)31(25(21-33)22-34)38-32(29,3)26-12-10-9-11-13-26/h9-17,20H,5-8,18-19H2,1-4H3/b17-15+ |
| InChIKey | ZTAQIMARLFYVAR-BMRADRMJSA-N |
| XLogP | 7.18 |
| TPSA | 93.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|