C40H37F3N4O2 — CID 88550943
2-[3-cyano-4-[(E)-2-[4-[(E)-2-[4-(dibutylamino)-2-methoxyphenyl]ethenyl]phenyl]ethenyl]-5-phenyl-5-(trifluoromethyl)furan-2-ylidene]propanedinitrile (PubChem CID 88550943) has the molecular formula C40H37F3N4O2 and a molecular weight of 662.76 g/mol. Its IUPAC name is 2-[3-cyano-4-[(E)-2-[4-[(E)-2-[4-(dibutylamino)-2-methoxyphenyl]ethenyl]phenyl]ethenyl]-5-phenyl-5-(trifluoromethyl)furan-2-ylidene]propanedinitrile.
| Compound Name | 2-[3-cyano-4-[(E)-2-[4-[(E)-2-[4-(dibutylamino)-2-methoxyphenyl]ethenyl]phenyl]ethenyl]-5-phenyl-5-(trifluoromethyl)furan-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 88550943 |
| Molecular Formula | C40H37F3N4O2 |
| Molecular Weight | 662.76 g/mol |
| Exact Mass | 662.29 |
| IUPAC Name | 2-[3-cyano-4-[(E)-2-[4-[(E)-2-[4-(dibutylamino)-2-methoxyphenyl]ethenyl]phenyl]ethenyl]-5-phenyl-5-(trifluoromethyl)furan-2-ylidene]propanedinitrile |
| SMILES | CCCCN(CCCC)c1ccc(/C=C/c2ccc(/C=C/C3=C(C#N)C(=C(C#N)C#N)OC3(c3ccccc3)C(F)(F)F)cc2)c(OC)c1 |
| InChI | InChI=1S/C40H37F3N4O2/c1-4-6-23-47(24-7-5-2)34-21-20-31(37(25-34)48-3)19-17-29-13-15-30(16-14-29)18-22-36-35(28-46)38(32(26-44)27-45)49-39(36,40(41,42)43)33-11-9-8-10-12-33/h8-22,25H,4-7,23-24H2,1-3H3/b19-17+,22-18+ |
| InChIKey | RCCNSLCSVCEPQY-UPYNRUSISA-N |
| XLogP | 9.89 |
| TPSA | 93.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.76 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|