C34H39N3O2 — CID 88856839
(2E)-2-(1-cyanoethylidene)-4-[(1E,3E)-4-[4-(dibutylamino)-2-methoxyphenyl]buta-1,3-dienyl]-5-methyl-5-phenylfuran-3-carbonitrile (PubChem CID 88856839) has the molecular formula C34H39N3O2 and a molecular weight of 521.71 g/mol. Its IUPAC name is (2E)-2-(1-cyanoethylidene)-4-[(1E,3E)-4-[4-(dibutylamino)-2-methoxyphenyl]buta-1,3-dienyl]-5-methyl-5-phenylfuran-3-carbonitrile.
| Compound Name | (2E)-2-(1-cyanoethylidene)-4-[(1E,3E)-4-[4-(dibutylamino)-2-methoxyphenyl]buta-1,3-dienyl]-5-methyl-5-phenylfuran-3-carbonitrile |
|---|---|
| PubChem CID | 88856839 |
| Molecular Formula | C34H39N3O2 |
| Molecular Weight | 521.71 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | (2E)-2-(1-cyanoethylidene)-4-[(1E,3E)-4-[4-(dibutylamino)-2-methoxyphenyl]buta-1,3-dienyl]-5-methyl-5-phenylfuran-3-carbonitrile |
| SMILES | CCCCN(CCCC)c1ccc(/C=C/C=C/C2=C(C#N)/C(=C(/C)C#N)OC2(C)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C34H39N3O2/c1-6-8-21-37(22-9-7-2)29-20-19-27(32(23-29)38-5)15-13-14-18-31-30(25-36)33(26(3)24-35)39-34(31,4)28-16-11-10-12-17-28/h10-20,23H,6-9,21-22H2,1-5H3/b15-13+,18-14+,33-26+ |
| InChIKey | KGZOTAYQRZQXJI-VPXMWPKOSA-N |
| XLogP | 8.23 |
| TPSA | 69.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.71 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|