C32H42N6O2 — CID 177444373
(Z)-2,3-bis[[4-(diethylamino)-2-propoxyphenyl]methylideneamino]but-2-enedinitrile (PubChem CID 177444373) has the molecular formula C32H42N6O2 and a molecular weight of 542.73 g/mol. Its IUPAC name is (Z)-2,3-bis[[4-(diethylamino)-2-propoxyphenyl]methylideneamino]but-2-enedinitrile.
| Compound Name | (Z)-2,3-bis[[4-(diethylamino)-2-propoxyphenyl]methylideneamino]but-2-enedinitrile |
|---|---|
| PubChem CID | 177444373 |
| Molecular Formula | C32H42N6O2 |
| Molecular Weight | 542.73 g/mol |
| Exact Mass | 542.34 |
| IUPAC Name | (Z)-2,3-bis[[4-(diethylamino)-2-propoxyphenyl]methylideneamino]but-2-enedinitrile |
| SMILES | CCCOc1cc(N(CC)CC)ccc1/C=N/C(C#N)=C(C#N)\N=C\c1ccc(N(CC)CC)cc1OCCC |
| InChI | InChI=1S/C32H42N6O2/c1-7-17-39-31-19-27(37(9-3)10-4)15-13-25(31)23-35-29(21-33)30(22-34)36-24-26-14-16-28(38(11-5)12-6)20-32(26)40-18-8-2/h13-16,19-20,23-24H,7-12,17-18H2,1-6H3/b30-29-,35-23+,36-24+ |
| InChIKey | JMMZVZULJOCUPN-FTYFVWOTSA-N |
| XLogP | 6.75 |
| TPSA | 97.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.73 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|