C17H21N3O — CID 3702433
2-[[4-(diethylamino)-2-propan-2-yloxyphenyl]methylidene]propanedinitrile (PubChem CID 3702433) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 2-[[4-(diethylamino)-2-propan-2-yloxyphenyl]methylidene]propanedinitrile.
| Compound Name | 2-[[4-(diethylamino)-2-propan-2-yloxyphenyl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 3702433 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 2-[[4-(diethylamino)-2-propan-2-yloxyphenyl]methylidene]propanedinitrile |
| SMILES | CCN(CC)c1ccc(C=C(C#N)C#N)c(OC(C)C)c1 |
| InChI | InChI=1S/C17H21N3O/c1-5-20(6-2)16-8-7-15(9-14(11-18)12-19)17(10-16)21-13(3)4/h7-10,13H,5-6H2,1-4H3 |
| InChIKey | PHHHCEUWHANUTM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 60.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|