C31H17N7O — CID 24813706
2-[[4-[4-(2,2-dicyanoethenyl)-N-[4-(2,2-dicyanoethenyl)-3-methoxyphenyl]anilino]phenyl]methylidene]propanedinitrile (PubChem CID 24813706) has the molecular formula C31H17N7O and a molecular weight of 503.53 g/mol. Its IUPAC name is 2-[[4-[4-(2,2-dicyanoethenyl)-N-[4-(2,2-dicyanoethenyl)-3-methoxyphenyl]anilino]phenyl]methylidene]propanedinitrile.
| Compound Name | 2-[[4-[4-(2,2-dicyanoethenyl)-N-[4-(2,2-dicyanoethenyl)-3-methoxyphenyl]anilino]phenyl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 24813706 |
| Molecular Formula | C31H17N7O |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 2-[[4-[4-(2,2-dicyanoethenyl)-N-[4-(2,2-dicyanoethenyl)-3-methoxyphenyl]anilino]phenyl]methylidene]propanedinitrile |
| SMILES | COc1cc(N(c2ccc(C=C(C#N)C#N)cc2)c2ccc(C=C(C#N)C#N)cc2)ccc1C=C(C#N)C#N |
| InChI | InChI=1S/C31H17N7O/c1-39-31-15-30(11-6-27(31)14-26(20-36)21-37)38(28-7-2-22(3-8-28)12-24(16-32)17-33)29-9-4-23(5-10-29)13-25(18-34)19-35/h2-15H,1H3 |
| InChIKey | YOIVVOBVEDMSSN-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 155.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|