C40H42N2O4 — CID 89455881
(E)-3-[4-[(E)-2-[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]ethenyl]-2,5-dimethoxyphenyl]-2-cyanoprop-2-enoic acid (PubChem CID 89455881) has the molecular formula C40H42N2O4 and a molecular weight of 614.79 g/mol. Its IUPAC name is (E)-3-[4-[(E)-2-[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]ethenyl]-2,5-dimethoxyphenyl]-2-cyanoprop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-2-[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]ethenyl]-2,5-dimethoxyphenyl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 89455881 |
| Molecular Formula | C40H42N2O4 |
| Molecular Weight | 614.79 g/mol |
| Exact Mass | 614.31 |
| IUPAC Name | (E)-3-[4-[(E)-2-[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]ethenyl]-2,5-dimethoxyphenyl]-2-cyanoprop-2-enoic acid |
| SMILES | COc1cc(/C=C(\C#N)C(=O)O)c(OC)cc1/C=C/c1ccc(N(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C40H42N2O4/c1-39(2,3)31-13-19-34(20-14-31)42(35-21-15-32(16-22-35)40(4,5)6)33-17-10-27(11-18-33)9-12-28-24-37(46-8)29(25-36(28)45-7)23-30(26-41)38(43)44/h9-25H,1-8H3,(H,43,44)/b12-9+,30-23+ |
| InChIKey | DOUCMPVBRPORMM-JQGVWWMCSA-N |
| XLogP | 9.93 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.79 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|