C38H36N2O5 — CID 142470377
8-[2-[(Z)-2-carboxy-2-cyanoethenyl]-5-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenoxy]octanoic acid (PubChem CID 142470377) has the molecular formula C38H36N2O5 and a molecular weight of 600.72 g/mol. Its IUPAC name is 8-[2-[(Z)-2-carboxy-2-cyanoethenyl]-5-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenoxy]octanoic acid.
| Compound Name | 8-[2-[(Z)-2-carboxy-2-cyanoethenyl]-5-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenoxy]octanoic acid |
|---|---|
| PubChem CID | 142470377 |
| Molecular Formula | C38H36N2O5 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | 8-[2-[(Z)-2-carboxy-2-cyanoethenyl]-5-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenoxy]octanoic acid |
| SMILES | N#C/C(=C/c1ccc(/C=C/c2ccc(N(c3ccccc3)c3ccccc3)cc2)cc1OCCCCCCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C38H36N2O5/c39-28-32(38(43)44)27-31-22-19-30(26-36(31)45-25-11-3-1-2-10-16-37(41)42)18-17-29-20-23-35(24-21-29)40(33-12-6-4-7-13-33)34-14-8-5-9-15-34/h4-9,12-15,17-24,26-27H,1-3,10-11,16,25H2,(H,41,42)(H,43,44)/b18-17+,32-27- |
| InChIKey | ZZLZFRHVJUCOBJ-YKUHZUOSSA-N |
| XLogP | 9.12 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|