C40H40N2O4 — CID 142470373
5-[2-[(Z)-2-cyano-3-oxoprop-1-enyl]-5-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenoxy]-2,3,3,4,4-pentamethylpentanoic acid (PubChem CID 142470373) has the molecular formula C40H40N2O4 and a molecular weight of 612.77 g/mol. Its IUPAC name is 5-[2-[(Z)-2-cyano-3-oxoprop-1-enyl]-5-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenoxy]-2,3,3,4,4-pentamethylpentanoic acid.
| Compound Name | 5-[2-[(Z)-2-cyano-3-oxoprop-1-enyl]-5-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenoxy]-2,3,3,4,4-pentamethylpentanoic acid |
|---|---|
| PubChem CID | 142470373 |
| Molecular Formula | C40H40N2O4 |
| Molecular Weight | 612.77 g/mol |
| Exact Mass | 612.30 |
| IUPAC Name | 5-[2-[(Z)-2-cyano-3-oxoprop-1-enyl]-5-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenoxy]-2,3,3,4,4-pentamethylpentanoic acid |
| SMILES | CC(C(=O)O)C(C)(C)C(C)(C)COc1cc(/C=C/c2ccc(N(c3ccccc3)c3ccccc3)cc2)ccc1/C=C(/C#N)C=O |
| InChI | InChI=1S/C40H40N2O4/c1-29(38(44)45)40(4,5)39(2,3)28-46-37-25-31(18-21-33(37)24-32(26-41)27-43)17-16-30-19-22-36(23-20-30)42(34-12-8-6-9-13-34)35-14-10-7-11-15-35/h6-25,27,29H,28H2,1-5H3,(H,44,45)/b17-16+,32-24- |
| InChIKey | BKIMSMBGRBHUDK-XTDOPQRYSA-N |
| XLogP | 9.58 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.77 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|