C27H23N3 — CID 58019380
(2E,5E)-2-isocyano-4,4-dimethyl-6-[4-(N-phenylanilino)phenyl]hexa-2,5-dienenitrile (PubChem CID 58019380) has the molecular formula C27H23N3 and a molecular weight of 389.50 g/mol. Its IUPAC name is (2E,5E)-2-isocyano-4,4-dimethyl-6-[4-(N-phenylanilino)phenyl]hexa-2,5-dienenitrile.
| Compound Name | (2E,5E)-2-isocyano-4,4-dimethyl-6-[4-(N-phenylanilino)phenyl]hexa-2,5-dienenitrile |
|---|---|
| PubChem CID | 58019380 |
| Molecular Formula | C27H23N3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | (2E,5E)-2-isocyano-4,4-dimethyl-6-[4-(N-phenylanilino)phenyl]hexa-2,5-dienenitrile |
| SMILES | [C-]#[N+]/C(C#N)=C/C(C)(C)/C=C/c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H23N3/c1-27(2,20-23(21-28)29-3)19-18-22-14-16-26(17-15-22)30(24-10-6-4-7-11-24)25-12-8-5-9-13-25/h4-20H,1-2H3/b19-18+,23-20+ |
| InChIKey | BJWSTVVRRFEQOE-WZUFFNFZSA-N |
| XLogP | 7.52 |
| TPSA | 31.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|