C24H14N4O — CID 11793799
2-[4-(N-(4-formylphenyl)anilino)phenyl]ethene-1,1,2-tricarbonitrile (PubChem CID 11793799) has the molecular formula C24H14N4O and a molecular weight of 374.40 g/mol. Its IUPAC name is 2-[4-(N-(4-formylphenyl)anilino)phenyl]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[4-(N-(4-formylphenyl)anilino)phenyl]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 11793799 |
| Molecular Formula | C24H14N4O |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 2-[4-(N-(4-formylphenyl)anilino)phenyl]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)c1ccc(N(c2ccccc2)c2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C24H14N4O/c25-14-20(15-26)24(16-27)19-8-12-23(13-9-19)28(21-4-2-1-3-5-21)22-10-6-18(17-29)7-11-22/h1-13,17H |
| InChIKey | BZRVQJKHFIJCJX-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 91.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|