C35H25N3 — CID 134194684
(E)-2-(4-methylphenyl)-3-[4-[4-(N-phenylanilino)phenyl]phenyl]but-2-enedinitrile (PubChem CID 134194684) has the molecular formula C35H25N3 and a molecular weight of 487.61 g/mol. Its IUPAC name is (E)-2-(4-methylphenyl)-3-[4-[4-(N-phenylanilino)phenyl]phenyl]but-2-enedinitrile.
| Compound Name | (E)-2-(4-methylphenyl)-3-[4-[4-(N-phenylanilino)phenyl]phenyl]but-2-enedinitrile |
|---|---|
| PubChem CID | 134194684 |
| Molecular Formula | C35H25N3 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | (E)-2-(4-methylphenyl)-3-[4-[4-(N-phenylanilino)phenyl]phenyl]but-2-enedinitrile |
| SMILES | Cc1ccc(/C(C#N)=C(\C#N)c2ccc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H25N3/c1-26-12-14-29(15-13-26)34(24-36)35(25-37)30-18-16-27(17-19-30)28-20-22-33(23-21-28)38(31-8-4-2-5-9-31)32-10-6-3-7-11-32/h2-23H,1H3/b35-34+ |
| InChIKey | CNOXAPUGKDZQQO-XAHDOWKMSA-N |
| XLogP | 9.09 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|