C68H46N2 — CID 102194233
(E)-2,3-bis[4-[4-(1,2,2-triphenylethenyl)phenyl]phenyl]but-2-enedinitrile (PubChem CID 102194233) has the molecular formula C68H46N2 and a molecular weight of 891.13 g/mol. Its IUPAC name is (E)-2,3-bis[4-[4-(1,2,2-triphenylethenyl)phenyl]phenyl]but-2-enedinitrile.
| Compound Name | (E)-2,3-bis[4-[4-(1,2,2-triphenylethenyl)phenyl]phenyl]but-2-enedinitrile |
|---|---|
| PubChem CID | 102194233 |
| Molecular Formula | C68H46N2 |
| Molecular Weight | 891.13 g/mol |
| Exact Mass | 890.37 |
| IUPAC Name | (E)-2,3-bis[4-[4-(1,2,2-triphenylethenyl)phenyl]phenyl]but-2-enedinitrile |
| SMILES | N#C/C(=C(/C#N)c1ccc(-c2ccc(C(=C(c3ccccc3)c3ccccc3)c3ccccc3)cc2)cc1)c1ccc(-c2ccc(C(=C(c3ccccc3)c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C68H46N2/c69-47-63(53-39-31-49(32-40-53)51-35-43-61(44-36-51)67(59-27-15-5-16-28-59)65(55-19-7-1-8-20-55)56-21-9-2-10-22-56)64(48-70)54-41-33-50(34-42-54)52-37-45-62(46-38-52)68(60-29-17-6-18-30-60)66(57-23-11-3-12-24-57)58-25-13-4-14-26-58/h1-46H/b64-63+ |
| InChIKey | IOQKOHYGWVBKRT-ZOPJMJKSSA-N |
| XLogP | 16.99 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.13 |
| LogP ≤ 5 | 16.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|